4-[2-bromoethyl(methyl)amino]but-2-ynyl N-(3-chlorophenyl)carbamate structure
|
Common Name | 4-[2-bromoethyl(methyl)amino]but-2-ynyl N-(3-chlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 123567-34-0 | Molecular Weight | 359.64600 | |
| Density | N/A | Boiling Point | 401.3ºC at 760 mmHg | |
| Molecular Formula | C14H16BrClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.5ºC | |
| Name | 4-[2-bromoethyl(methyl)amino]but-2-ynyl N-(3-chlorophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 401.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H16BrClN2O2 |
| Molecular Weight | 359.64600 |
| Flash Point | 196.5ºC |
| Exact Mass | 358.00800 |
| PSA | 45.06000 |
| LogP | 3.23220 |
| Vapour Pressure | 1.19E-06mmHg at 25°C |
| InChIKey | SWJSAKZDVODBPF-UHFFFAOYSA-N |
| SMILES | CN(CC#CCOC(=O)Nc1cccc(Cl)c1)CCBr |
|
~%
4-[2-bromoethyl... CAS#:123567-34-0 |
| Literature: Ringdahl, Bjoern; Mellin, Charlotta; Ehlert, Frederick J.; Roch, Margareth; Rice, Kathleen M.; Jenden, Donald J. Journal of Medicinal Chemistry, 1990 , vol. 33, # 1 p. 281 - 286 |
|
~%
4-[2-bromoethyl... CAS#:123567-34-0 |
| Literature: Ringdahl, Bjoern; Mellin, Charlotta; Ehlert, Frederick J.; Roch, Margareth; Rice, Kathleen M.; Jenden, Donald J. Journal of Medicinal Chemistry, 1990 , vol. 33, # 1 p. 281 - 286 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Carbamic acid,(3-chlorophenyl)-,4-((2-bromoethyl)methylamino)-2-butynyl ester |
| BR-384 |
| 4-((2-Bromoethyl)methylamino)-2-butynyl N-(3-chlorophenyl)carbamate |
| 4-((2-Bromoethyl)methylamino)-2-butynyl (3-chlorophenyl)carbamate |