Benzenepropanal,N-2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | Benzenepropanal,N-2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 1237-68-9 | Molecular Weight | 314.29600 | |
| Density | 1.32g/cm3 | Boiling Point | 498.6ºC at 760mmHg | |
| Molecular Formula | C15H14N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.3ºC | |
| Name | 2,4-dinitro-N-(3-phenylpropylideneamino)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 498.6ºC at 760mmHg |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.29600 |
| Flash Point | 255.3ºC |
| Exact Mass | 314.10200 |
| PSA | 116.03000 |
| LogP | 4.65290 |
| Vapour Pressure | 4.48E-10mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | VYACQSBKFHFBMC-MHWRWJLKSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=CCCc2ccccc2)c([N+](=O)[O-])c1 |
|
~%
Benzenepropanal... CAS#:1237-68-9 |
| Literature: Chen, Jiang-Min; Zeng, Xiao-Mei; Middleton, Kyle; Zhdankin, Viktor V. Tetrahedron Letters, 2011 , vol. 52, # 16 p. 1952 - 1955 |
|
~90%
Benzenepropanal... CAS#:1237-68-9 |
| Literature: Oskooie, Hossien A.; Heravi, Majid M.; Sadnia, Akbar; Safarzadegan, Mehrak; Behbahani, Farahnaz K. Mendeleev Communications, 2007 , vol. 17, # 3 p. 190 - 191 |
|
~%
Benzenepropanal... CAS#:1237-68-9 |
| Literature: Yoshimura, Akira; Banek, Christopher T.; Yusubov, Mekhman S.; Nemykin, Victor N.; Zhdankin, Viktor V. Journal of Organic Chemistry, 2011 , vol. 76, # 10 p. 3812 - 3819 |
| hydrocinnamaldehyde 2,4-dinitrophenylhydrazone |
| Esimil |
| Ziac |
| Drenol |
| Bremil |
| Direma |
| Zide |
| HCTZ |
| HCZ |
| hydrodiuril |
| 6-chloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulphonamide-1,1-dioxide |
| 3-phenyl-1-propanal 2,4-dinitrophenylhydrazone |
| 6-chloro-3,4-dihydro-1,1-dioxo-7-sulfamoyl-1,2,4-benzothiadiazine |
| Cidrex |
| Fluvin |