Benzenepropanal,N-2-(2,4-dinitrophenyl)hydrazone
Benzenepropanal,N-2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | Benzenepropanal,N-2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 1237-68-9 | Molecular Weight | 314.29600 | |
| Density | 1.32g/cm3 | Boiling Point | 498.6ºC at 760mmHg | |
| Molecular Formula | C15H14N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.3ºC | |
Summary: 2,4-Dinitro-N-(3-phenylpropylideneamino)aniline (also known as Benzenepropanal,N-2-(2,4-dinitrophenyl)hydrazone), CAS No. 1237-68-9, molecular formula C15H14N4O4, molecular weight 314.29600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dinitro-N-(3-phenylpropylideneamino)aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 498.6ºC at 760mmHg |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.29600 |
| Flash Point | 255.3ºC |
| Exact Mass | 314.10200 |
| PSA | 116.03000 |
| LogP | 4.65290 |
| Vapour Pressure | 4.48E-10mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | VYACQSBKFHFBMC-MHWRWJLKSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=CCCc2ccccc2)c([N+](=O)[O-])c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Benzenepropanal... CAS#:1237-68-9 |
| Literature: Chen, Jiang-Min; Zeng, Xiao-Mei; Middleton, Kyle; Zhdankin, Viktor V. Tetrahedron Letters, 2011 , vol. 52, # 16 p. 1952 - 1955 |
|
~90%
Benzenepropanal... CAS#:1237-68-9 |
| Literature: Oskooie, Hossien A.; Heravi, Majid M.; Sadnia, Akbar; Safarzadegan, Mehrak; Behbahani, Farahnaz K. Mendeleev Communications, 2007 , vol. 17, # 3 p. 190 - 191 |
|
~%
Benzenepropanal... CAS#:1237-68-9 |
| Literature: Yoshimura, Akira; Banek, Christopher T.; Yusubov, Mekhman S.; Nemykin, Victor N.; Zhdankin, Viktor V. Journal of Organic Chemistry, 2011 , vol. 76, # 10 p. 3812 - 3819 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| hydrocinnamaldehyde 2,4-dinitrophenylhydrazone |
| Esimil |
| Ziac |
| Drenol |
| Bremil |
| Direma |
| Zide |
| HCTZ |
| HCZ |
| hydrodiuril |
| 6-chloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulphonamide-1,1-dioxide |
| 3-phenyl-1-propanal 2,4-dinitrophenylhydrazone |
| 6-chloro-3,4-dihydro-1,1-dioxo-7-sulfamoyl-1,2,4-benzothiadiazine |
| Cidrex |
| Fluvin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline? |
| A: Related upstream materials(CAS) of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline: 104-53-0;119-26-6;1197-50-8;122-97-4. |
| Q: What is the molecular formula of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline? |
| A: Molecular formula of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline is C15H14N4O4. |
| Q: What is the SMILES notation of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline? |
| A: SMILES notation of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline is O=[N+]([O-])c1ccc(NN=CCCc2ccccc2)c([N+](=O)[O-])c1. |
| Q: What is the Chinese name of 1237-68-9? |
| A: Chinese name of 1237-68-9 is 1237-68-9. |
| Q: What is the polar surface area (PSA) of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline? |
| A: Polar surface area (PSA) of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline is 116.03000. |
| Q: What English synonyms does 2,4-dinitro-N-(3-phenylpropylideneamino)aniline have? |
| A: English synonyms of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline: hydrocinnamaldehyde 2,4-dinitrophenylhydrazone, Esimil, Ziac, Drenol, Bremil, Direma, Zide, HCTZ, HCZ, hydrodiuril, 6-chloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulphonamide-1,1-dioxide, 3-phenyl-1-propanal 2,4-dinitrophenylhydrazone, 6-chloro-3,4-dihydro-1,1-dioxo-7-sulfamoyl-1,2,4-benzothiadiazine, Cidrex, Fluvin. |
| Q: What is the LogP of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline? |
| A: LogP of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline is 4.65290. |
| Q: What is the molecular weight of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline? |
| A: Molecular weight of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline is 314.29600. |
| Q: What is the boiling point of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline? |
| A: Boiling point of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline is 498.6ºC at 760mmHg. |
| Q: What is the CAS number of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline? |
| A: CAS number of 2,4-dinitro-N-(3-phenylpropylideneamino)aniline is 1237-68-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |