4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester
Modify Date: 2026-09-30 16:19:56
4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester structure
|
Common Name | 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1237104-04-9 | Molecular Weight | 325.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H10F3NO4 |
|---|---|
| Molecular Weight | 325.24 |
| InChIKey | ZDRAARGHPGDUIF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(-c2cccc(C(F)(F)F)c2)ccc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester? |
| A: The English name of 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester is 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester. |
| Q: What is the SMILES notation of 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester? |
| A: SMILES notation of 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester is COC(=O)c1cc(-c2cccc(C(F)(F)F)c2)ccc1[N+](=O)[O-]. |
| Q: What is the molecular weight of 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester? |
| A: Molecular weight of 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester is 325.24. |
| Q: What is the molecular formula of 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester? |
| A: Molecular formula of 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester is C15H10F3NO4. |
| Q: What is the Chinese name of 1237104-04-9? |
| A: Chinese name of 1237104-04-9 is 1237104-04-9. |
| Q: What is the CAS number of 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester? |
| A: CAS number of 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester is 1237104-04-9. |
| Q: What is the InChIKey of 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester? |
| A: InChIKey of 4-Nitro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester is ZDRAARGHPGDUIF-UHFFFAOYSA-N. |