3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl
Modify Date: 2026-09-26 19:46:52
3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl structure
|
Common Name | 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl | ||
|---|---|---|---|---|
| CAS Number | 1237108-56-3 | Molecular Weight | 305.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9Cl2F3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H9Cl2F3 |
|---|---|
| Molecular Weight | 305.1 |
| InChIKey | FEYJAEGTAORGND-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(-c2ccc(CCl)c(Cl)c2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl? |
| A: InChIKey of 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl is FEYJAEGTAORGND-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl? |
| A: CAS number of 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl is 1237108-56-3. |
| Q: What is the molecular formula of 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl? |
| A: Molecular formula of 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl is C14H9Cl2F3. |
| Q: What is the Chinese name of 1237108-56-3? |
| A: Chinese name of 1237108-56-3 is 1237108-56-3. |
| Q: What is the English name of 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl? |
| A: The English name of 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl is 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl. |
| Q: What is the molecular weight of 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl? |
| A: Molecular weight of 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl is 305.1. |
| Q: What is the SMILES notation of 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl? |
| A: SMILES notation of 3-Chloro-4-chloromethyl-3'-(trifluoromethyl)biphenyl is FC(F)(F)c1cccc(-c2ccc(CCl)c(Cl)c2)c1. |