3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide
Modify Date: 2025-09-06 11:59:19
3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide structure
|
Common Name | 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide | ||
|---|---|---|---|---|
| CAS Number | 1237109-40-8 | Molecular Weight | 299.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H9ClF3NO |
|---|---|
| Molecular Weight | 299.67 |
| InChIKey | DDHNPKJFFVITLE-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(-c2ccccc2C(F)(F)F)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide? |
| A: InChIKey of 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide is DDHNPKJFFVITLE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide? |
| A: CAS number of 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide is 1237109-40-8. |
| Q: What is the Chinese name of 1237109-40-8? |
| A: Chinese name of 1237109-40-8 is 1237109-40-8. |
| Q: What is the English name of 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide? |
| A: The English name of 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide is 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide. |
| Q: What is the SMILES notation of 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide? |
| A: SMILES notation of 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide is NC(=O)c1ccc(-c2ccccc2C(F)(F)F)cc1Cl. |
| Q: What is the molecular weight of 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide? |
| A: Molecular weight of 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide is 299.67. |
| Q: What is the molecular formula of 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide? |
| A: Molecular formula of 3-Chloro-2'-(trifluoromethyl)biphenyl-4-carboxylic acid amide is C14H9ClF3NO. |