4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde
Modify Date: 2025-11-05 15:30:22
4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde structure
|
Common Name | 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 1237115-27-3 | Molecular Weight | 284.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8ClF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H8ClF3O |
|---|---|
| Molecular Weight | 284.66 |
| InChIKey | BBVIBOLIBUGHOY-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(-c2cccc(C(F)(F)F)c2)ccc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1237115-27-3? |
| A: Chinese name of 1237115-27-3 is 1237115-27-3. |
| Q: What is the molecular weight of 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde? |
| A: Molecular weight of 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde is 284.66. |
| Q: What is the molecular formula of 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde? |
| A: Molecular formula of 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde is C14H8ClF3O. |
| Q: What is the SMILES notation of 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde? |
| A: SMILES notation of 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde is O=Cc1cc(-c2cccc(C(F)(F)F)c2)ccc1Cl. |
| Q: What is the InChIKey of 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde? |
| A: InChIKey of 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde is BBVIBOLIBUGHOY-UHFFFAOYSA-N. |
| Q: What is the English name of 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde? |
| A: The English name of 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde is 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde. |
| Q: What is the CAS number of 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde? |
| A: CAS number of 4-Chloro-3'-(trifluoromethyl)biphenyl-3-carbaldehyde is 1237115-27-3. |