4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl
Modify Date: 2026-08-18 17:42:05
4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl structure
|
Common Name | 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 1237121-19-5 | Molecular Weight | 276.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H11F3O |
|---|---|
| Molecular Weight | 276.25 |
| InChIKey | QDMMDKBPNYDCTE-UHFFFAOYSA-N |
| SMILES | C#Cc1ccc(-c2cccc(C(F)(F)F)c2)cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl? |
| A: InChIKey of 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl is QDMMDKBPNYDCTE-UHFFFAOYSA-N. |
| Q: What is the English name of 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl? |
| A: The English name of 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl is 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl. |
| Q: What is the molecular weight of 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl? |
| A: Molecular weight of 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl is 276.25. |
| Q: What is the CAS number of 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl? |
| A: CAS number of 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl is 1237121-19-5. |
| Q: What is the Chinese name of 1237121-19-5? |
| A: Chinese name of 1237121-19-5 is 1237121-19-5. |
| Q: What is the SMILES notation of 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl? |
| A: SMILES notation of 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl is C#Cc1ccc(-c2cccc(C(F)(F)F)c2)cc1OC. |
| Q: What is the molecular formula of 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl? |
| A: Molecular formula of 4-Ethynyl-3-methoxy-3'-(trifluoromethyl)-1,1'-biphenyl is C16H11F3O. |