3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid structure
|
Common Name | 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1237139-10-4 | Molecular Weight | 291.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11BrO2 |
|---|---|
| Molecular Weight | 291.14 |
| InChIKey | YTERHWZJBNJNGW-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-c2ccc(C(=O)O)c(Br)c2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid? |
| A: InChIKey of 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid is YTERHWZJBNJNGW-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid? |
| A: The English name of 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid is 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid. |
| Q: What is the molecular formula of 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid? |
| A: Molecular formula of 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid is C14H11BrO2. |
| Q: What is the CAS number of 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid? |
| A: CAS number of 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid is 1237139-10-4. |
| Q: What is the SMILES notation of 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid? |
| A: SMILES notation of 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid is Cc1cccc(-c2ccc(C(=O)O)c(Br)c2)c1. |
| Q: What is the Chinese name of 1237139-10-4? |
| A: Chinese name of 1237139-10-4 is 1237139-10-4. |
| Q: What is the molecular weight of 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid? |
| A: Molecular weight of 3-Bromo-3'-methyl-[1,1'-biphenyl]-4-carboxylic acid is 291.14. |