Ammiol glucoside
Modify Date: 2025-09-28 16:34:04
Ammiol glucoside structure
|
Common Name | Ammiol glucoside | ||
|---|---|---|---|---|
| CAS Number | 123715-08-2 | Molecular Weight | 438.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H22O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ammiol glucoside |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H22O11 |
|---|---|
| Molecular Weight | 438.4 |
| InChIKey | CLABIQPMDJOSBJ-ZHQGELOASA-N |
| SMILES | COc1c2occc2c(OC)c2c(=O)cc(COC3OC(CO)C(O)C(O)C3O)oc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Ammiol glucoside? |
| A: Molecular weight of Ammiol glucoside is 438.4. |
| Q: What is the InChIKey of Ammiol glucoside? |
| A: InChIKey of Ammiol glucoside is CLABIQPMDJOSBJ-ZHQGELOASA-N. |
| Q: What is the Chinese name of 123715-08-2? |
| A: Chinese name of 123715-08-2 is 123715-08-2. |
| Q: What is the English name of Ammiol glucoside? |
| A: The English name of Ammiol glucoside is Ammiol glucoside. |
| Q: What is the molecular formula of Ammiol glucoside? |
| A: Molecular formula of Ammiol glucoside is C20H22O11. |
| Q: What is the CAS number of Ammiol glucoside? |
| A: CAS number of Ammiol glucoside is 123715-08-2. |
| Q: What is the SMILES notation of Ammiol glucoside? |
| A: SMILES notation of Ammiol glucoside is COc1c2occc2c(OC)c2c(=O)cc(COC3OC(CO)C(O)C(O)C3O)oc12. |