4-Formyl-17beta-estradiol
Modify Date: 2026-06-27 19:21:15
4-Formyl-17beta-estradiol structure
|
Common Name | 4-Formyl-17beta-estradiol | ||
|---|---|---|---|---|
| CAS Number | 123715-79-7 | Molecular Weight | 300.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Formyl-17beta-estradiol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H24O3 |
|---|---|
| Molecular Weight | 300.4 |
| InChIKey | GUJSHAHJIQWGNF-AFTVQHQSSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4C=O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of aromatase in human placental microsomes using [1beta-3H]AD as substrate...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL5241253
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-Formyl-17beta-estradiol? |
| A: Molecular formula of 4-Formyl-17beta-estradiol is C19H24O3. |
| Q: What is the InChIKey of 4-Formyl-17beta-estradiol? |
| A: InChIKey of 4-Formyl-17beta-estradiol is GUJSHAHJIQWGNF-AFTVQHQSSA-N. |
| Q: What is the SMILES notation of 4-Formyl-17beta-estradiol? |
| A: SMILES notation of 4-Formyl-17beta-estradiol is C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4C=O)O. |
| Q: What is the Chinese name of 123715-79-7? |
| A: Chinese name of 123715-79-7 is 123715-79-7. |
| Q: What is the English name of 4-Formyl-17beta-estradiol? |
| A: The English name of 4-Formyl-17beta-estradiol is 4-Formyl-17beta-estradiol. |
| Q: What is the CAS number of 4-Formyl-17beta-estradiol? |
| A: CAS number of 4-Formyl-17beta-estradiol is 123715-79-7. |
| Q: What is the molecular weight of 4-Formyl-17beta-estradiol? |
| A: Molecular weight of 4-Formyl-17beta-estradiol is 300.4. |