Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate
Modify Date: 2025-09-15 19:20:44
Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate structure
|
Common Name | Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1237171-25-3 | Molecular Weight | 223.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14FNO2 |
|---|---|
| Molecular Weight | 223.24 |
| InChIKey | REBCUOWHHZXWGJ-MNOVXSKESA-N |
| SMILES | COC(=O)C1CNCC1c1ccc(F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate? |
| A: Molecular weight of Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate is 223.24. |
| Q: What is the CAS number of Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate? |
| A: CAS number of Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate is 1237171-25-3. |
| Q: What is the Chinese name of 1237171-25-3? |
| A: Chinese name of 1237171-25-3 is 1237171-25-3. |
| Q: What is the molecular formula of Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate? |
| A: Molecular formula of Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate is C12H14FNO2. |
| Q: What is the SMILES notation of Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate? |
| A: SMILES notation of Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate is COC(=O)C1CNCC1c1ccc(F)cc1. |
| Q: What is the InChIKey of Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate? |
| A: InChIKey of Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate is REBCUOWHHZXWGJ-MNOVXSKESA-N. |
| Q: What is the English name of Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate? |
| A: The English name of Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate is Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate. |