2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline
![2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline Structure](https://image.chemsrc.com/caspic/335/123724-12-9.png)
2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline structure
|
Common Name | 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline | ||
|---|---|---|---|---|
| CAS Number | 123724-12-9 | Molecular Weight | 317.34500 | |
| Density | 1.328g/cm3 | Boiling Point | 568ºC at 760 mmHg | |
| Molecular Formula | C18H15N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 568ºC at 760 mmHg |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.34500 |
| Flash Point | 198.4ºC |
| Exact Mass | 317.12800 |
| PSA | 76.58000 |
| LogP | 2.91770 |
| Vapour Pressure | 6.41E-13mmHg at 25°C |
| Index of Refraction | 1.69 |
| InChIKey | PQCFEOVZOWBTSB-UHFFFAOYSA-N |
| SMILES | c1cc(Cc2nn[nH]n2)cc(OCc2ccc3ccccc3n2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~52%
2-[[3-(2H-tetra... CAS#:123724-12-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 1 p. 240 - 245 |
|
~%
2-[[3-(2H-tetra... CAS#:123724-12-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 1 p. 240 - 245 |
|
~%
2-[[3-(2H-tetra... CAS#:123724-12-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 1 p. 240 - 245 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Quinoline,2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl] |
| 2-<<3-(1H-tetrazol-5-ylmethyl)phenoxy>methyl>quinoline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 123724-12-9? |
| A: Chinese name of 123724-12-9 is 123724-12-9. |
| Q: What are the upstream materials of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline? |
| A: Related upstream materials(CAS) of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline: 4377-41-7;25263-44-9. |
| Q: What is the polar surface area (PSA) of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline? |
| A: Polar surface area (PSA) of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline is 76.58000. |
| Q: What is the molecular weight of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline? |
| A: Molecular weight of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline is 317.34500. |
| Q: What is the LogP of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline? |
| A: LogP of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline is 2.91770. |
| Q: What is the English name of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline? |
| A: The English name of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline is 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline. |
| Q: What is the SMILES notation of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline? |
| A: SMILES notation of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline is c1cc(Cc2nn[nH]n2)cc(OCc2ccc3ccccc3n2)c1. |
| Q: What is the InChIKey of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline? |
| A: InChIKey of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline is PQCFEOVZOWBTSB-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline? |
| A: CAS number of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline is 123724-12-9. |
| Q: What is the boiling point of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline? |
| A: Boiling point of 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline is 568ºC at 760 mmHg. |