2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline structure
|
Common Name | 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline | ||
|---|---|---|---|---|
| CAS Number | 123724-12-9 | Molecular Weight | 317.34500 | |
| Density | 1.328g/cm3 | Boiling Point | 568ºC at 760 mmHg | |
| Molecular Formula | C18H15N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.4ºC | |
| Name | 2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl]quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 568ºC at 760 mmHg |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.34500 |
| Flash Point | 198.4ºC |
| Exact Mass | 317.12800 |
| PSA | 76.58000 |
| LogP | 2.91770 |
| Vapour Pressure | 6.41E-13mmHg at 25°C |
| Index of Refraction | 1.69 |
| InChIKey | PQCFEOVZOWBTSB-UHFFFAOYSA-N |
| SMILES | c1cc(Cc2nn[nH]n2)cc(OCc2ccc3ccccc3n2)c1 |
|
~52%
2-[[3-(2H-tetra... CAS#:123724-12-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 1 p. 240 - 245 |
|
~%
2-[[3-(2H-tetra... CAS#:123724-12-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 1 p. 240 - 245 |
|
~%
2-[[3-(2H-tetra... CAS#:123724-12-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 1 p. 240 - 245 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Quinoline,2-[[3-(2H-tetrazol-5-ylmethyl)phenoxy]methyl] |
| 2-<<3-(1H-tetrazol-5-ylmethyl)phenoxy>methyl>quinoline |