4-(2-Quinolinylmethoxy)benzoicacid structure
|
Common Name | 4-(2-Quinolinylmethoxy)benzoicacid | ||
|---|---|---|---|---|
| CAS Number | 123724-16-3 | Molecular Weight | 279.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(quinolin-2-ylmethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H13NO3 |
|---|---|
| Molecular Weight | 279.29000 |
| Exact Mass | 279.09000 |
| PSA | 59.42000 |
| LogP | 3.51200 |
| InChIKey | NNJZADJXPQFKOE-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OCc2ccc3ccccc3n2)cc1 |
| HS Code | 2933499090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Agonist activity against human GPBAR1 expressed in HEK293T cells assessed as transact...
Source: ChEMBL
Target: G-protein coupled bile acid receptor 1
External Id: CHEMBL5133048
|
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Antagonist activity against human CysLT1 expressed in CHO cells assessed as inhibitio...
Source: ChEMBL
Target: Cysteinyl leukotriene receptor 1
External Id: CHEMBL5133046
|
| f2158-0589 |