5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one
Modify Date: 2026-08-06 12:08:47
5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one structure
|
Common Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 123731-49-7 | Molecular Weight | 270.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H10O5 |
|---|---|
| Molecular Weight | 270.24 |
| InChIKey | RNDJNKALHAHPCA-UHFFFAOYSA-N |
| SMILES | O=c1oc2cc(O)cc(O)c2cc1-c1ccc(O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one? |
| A: CAS number of 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one is 123731-49-7. |
| Q: What is the SMILES notation of 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one? |
| A: SMILES notation of 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one is O=c1oc2cc(O)cc(O)c2cc1-c1ccc(O)cc1. |
| Q: What is the molecular formula of 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one? |
| A: Molecular formula of 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one is C15H10O5. |
| Q: What is the InChIKey of 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one? |
| A: InChIKey of 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one is RNDJNKALHAHPCA-UHFFFAOYSA-N. |
| Q: What is the English name of 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one? |
| A: The English name of 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one is 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one. |
| Q: What is the molecular weight of 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one? |
| A: Molecular weight of 5,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one is 270.24. |
| Q: What is the Chinese name of 123731-49-7? |
| A: Chinese name of 123731-49-7 is 123731-49-7. |