3-(4-CYANOPHENYL)CYCLOHEXANONE
3-(4-CYANOPHENYL)CYCLOHEXANONE structure
|
Common Name | 3-(4-CYANOPHENYL)CYCLOHEXANONE | ||
|---|---|---|---|---|
| CAS Number | 123732-09-2 | Molecular Weight | 199.24800 | |
| Density | 1.123g/cm3 | Boiling Point | 367.332ºC at 760 mmHg | |
| Molecular Formula | C13H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.957ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(3-oxocyclohexyl)benzonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 367.332ºC at 760 mmHg |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.24800 |
| Flash Point | 175.957ºC |
| Exact Mass | 199.10000 |
| PSA | 40.86000 |
| LogP | 2.78498 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | YERDBWDYWNZYDJ-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C2CCCC(=O)C2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(4-cyanophenyl)cyclohexanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-(3-oxocyclohexyl)benzonitrile? |
| A: LogP of 4-(3-oxocyclohexyl)benzonitrile is 2.78498. |
| Q: What is the molecular formula of 4-(3-oxocyclohexyl)benzonitrile? |
| A: Molecular formula of 4-(3-oxocyclohexyl)benzonitrile is C13H13NO. |
| Q: What is the SMILES notation of 4-(3-oxocyclohexyl)benzonitrile? |
| A: SMILES notation of 4-(3-oxocyclohexyl)benzonitrile is N#Cc1ccc(C2CCCC(=O)C2)cc1. |
| Q: What is the polar surface area (PSA) of 4-(3-oxocyclohexyl)benzonitrile? |
| A: Polar surface area (PSA) of 4-(3-oxocyclohexyl)benzonitrile is 40.86000. |
| Q: What is the InChIKey of 4-(3-oxocyclohexyl)benzonitrile? |
| A: InChIKey of 4-(3-oxocyclohexyl)benzonitrile is YERDBWDYWNZYDJ-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 4-(3-oxocyclohexyl)benzonitrile? |
| A: Related upstream materials(CAS) of 4-(3-oxocyclohexyl)benzonitrile: 930-68-7;3058-39-7;623-26-7;108-94-1. |
| Q: What English synonyms does 4-(3-oxocyclohexyl)benzonitrile have? |
| A: English synonyms of 4-(3-oxocyclohexyl)benzonitrile: 3-(4-cyanophenyl)cyclohexanone. |
| Q: What is the English name of 4-(3-oxocyclohexyl)benzonitrile? |
| A: The English name of 4-(3-oxocyclohexyl)benzonitrile is 4-(3-oxocyclohexyl)benzonitrile. |
| Q: What is the CAS number of 4-(3-oxocyclohexyl)benzonitrile? |
| A: CAS number of 4-(3-oxocyclohexyl)benzonitrile is 123732-09-2. |
| Q: What is the Chinese name of 123732-09-2? |
| A: Chinese name of 123732-09-2 is 123732-09-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |