Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate
Modify Date: 2026-08-02 18:23:42
![Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate Structure](https://www.chemsrc.com/extcaspic/467/123732-45-6.png)
Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate structure
|
Common Name | Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 123732-45-6 | Molecular Weight | 226.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14N2O4 |
|---|---|
| Molecular Weight | 226.23 |
| InChIKey | DFCRMTHDZOSMFT-UHFFFAOYSA-N |
| SMILES | COC(=O)N1CCCc2onc(OC)c2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate? |
| A: InChIKey of Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate is DFCRMTHDZOSMFT-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate? |
| A: SMILES notation of Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate is COC(=O)N1CCCc2onc(OC)c2C1. |
| Q: What is the English name of Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate? |
| A: The English name of Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate is Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate. |
| Q: What is the molecular formula of Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate? |
| A: Molecular formula of Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate is C10H14N2O4. |
| Q: What is the CAS number of Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate? |
| A: CAS number of Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate is 123732-45-6. |
| Q: What is the molecular weight of Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate? |
| A: Molecular weight of Methyl 3-Methoxy-5,6,7,8-tetrahydro-4H-isoxazolo[4,5-c]azepin-5-carboxylate is 226.23. |
| Q: What is the Chinese name of 123732-45-6? |
| A: Chinese name of 123732-45-6 is 123732-45-6. |