Alfuzosin, (S)
Modify Date: 2026-06-23 18:48:05
Alfuzosin, (S) structure
|
Common Name | Alfuzosin, (S) | ||
|---|---|---|---|---|
| CAS Number | 123739-70-8 | Molecular Weight | 389.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H27N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Alfuzosin, (S) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H27N5O4 |
|---|---|
| Molecular Weight | 389.4 |
| InChIKey | WNMJYKCGWZFFKR-AWEZNQCLSA-N |
| SMILES | CN(CCCNC(=O)[C@@H]1CCCO1)C2=NC3=CC(=C(C=C3C(=N2)N)OC)OC |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: S16 Schwann cell viability assay (CellTiter-Glo assay)
Source: NCGC
Target: N/A
External Id: cmt-p4-fda-celltiter_regid
|
|
Name: Biochemical firefly luciferase enzyme assay for NPC
Source: NCGC
Target: Luciferase [Photinus pyralis]
External Id: adst-fluc-km-fda-o1_regid
|
|
Name: S16 Schwann cell PMP22 intronic element firefly luciferase assay
Source: NCGC
Target: peripheral myelin protein 22 [Rattus norvegicus]
External Id: cmt-p4-fluc-fda_regid
|
|
Name: qHTS for Inhibitors of Polymerase Kappa
Source: NCGC
Target: DNA polymerase kappa [Homo sapiens]
External Id: PolK100
|
Total 4, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 123739-70-8? |
| A: Chinese name of 123739-70-8 is 123739-70-8. |
| Q: What is the molecular formula of Alfuzosin, (S)? |
| A: Molecular formula of Alfuzosin, (S) is C19H27N5O4. |
| Q: What is the molecular weight of Alfuzosin, (S)? |
| A: Molecular weight of Alfuzosin, (S) is 389.4. |
| Q: What is the English name of Alfuzosin, (S)? |
| A: The English name of Alfuzosin, (S) is Alfuzosin, (S). |
| Q: What is the SMILES notation of Alfuzosin, (S)? |
| A: SMILES notation of Alfuzosin, (S) is CN(CCCNC(=O)[C@@H]1CCCO1)C2=NC3=CC(=C(C=C3C(=N2)N)OC)OC. |
| Q: What is the InChIKey of Alfuzosin, (S)? |
| A: InChIKey of Alfuzosin, (S) is WNMJYKCGWZFFKR-AWEZNQCLSA-N. |
| Q: What is the CAS number of Alfuzosin, (S)? |
| A: CAS number of Alfuzosin, (S) is 123739-70-8. |