Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate
Modify Date: 2026-07-24 20:32:33
Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate structure
|
Common Name | Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 1237494-95-9 | Molecular Weight | 247.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21NO2 |
|---|---|
| Molecular Weight | 247.33 |
| InChIKey | VLBUVJJTIVXKAI-QWHCGFSZSA-N |
| SMILES | Cc1cccc(C2CC2NC(=O)OC(C)(C)C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1237494-95-9? |
| A: Chinese name of 1237494-95-9 is 1237494-95-9. |
| Q: What is the English name of Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate? |
| A: The English name of Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate is Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate. |
| Q: What is the molecular formula of Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate? |
| A: Molecular formula of Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate is C15H21NO2. |
| Q: What is the CAS number of Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate? |
| A: CAS number of Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate is 1237494-95-9. |
| Q: What is the molecular weight of Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate? |
| A: Molecular weight of Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate is 247.33. |
| Q: What is the SMILES notation of Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate? |
| A: SMILES notation of Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate is Cc1cccc(C2CC2NC(=O)OC(C)(C)C)c1. |
| Q: What is the InChIKey of Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate? |
| A: InChIKey of Rel-tert-butyl ((1R,2S)-2-(m-tolyl)cyclopropyl)carbamate is VLBUVJJTIVXKAI-QWHCGFSZSA-N. |