(2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid
Modify Date: 2026-08-03 11:14:27
![(2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid Structure](https://www.chemsrc.com/extcaspic/363/123760-95-2.png)
(2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid structure
|
Common Name | (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 123760-95-2 | Molecular Weight | 213.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12ClNO2 |
|---|---|
| Molecular Weight | 213.66 |
| InChIKey | FBMVXXOKUYWDEC-ZETCQYMHSA-N |
| SMILES | CC(NCc1ccc(Cl)cc1)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid? |
| A: InChIKey of (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid is FBMVXXOKUYWDEC-ZETCQYMHSA-N. |
| Q: What is the molecular formula of (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid? |
| A: Molecular formula of (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid is C10H12ClNO2. |
| Q: What is the CAS number of (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid? |
| A: CAS number of (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid is 123760-95-2. |
| Q: What is the SMILES notation of (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid? |
| A: SMILES notation of (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid is CC(NCc1ccc(Cl)cc1)C(=O)O. |
| Q: What is the Chinese name of 123760-95-2? |
| A: Chinese name of 123760-95-2 is 123760-95-2. |
| Q: What is the English name of (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid? |
| A: The English name of (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid is (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid. |
| Q: What is the molecular weight of (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid? |
| A: Molecular weight of (2S)-2-{[(4-chlorophenyl)methyl]amino}propanoic acid is 213.66. |