benzyl 3-hydroxycyclohexanecarboxylate
Modify Date: 2026-02-01 15:52:26
benzyl 3-hydroxycyclohexanecarboxylate structure
|
Common Name | benzyl 3-hydroxycyclohexanecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 123762-07-2 | Molecular Weight | 234.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl 3-hydroxycyclohexanecarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18O3 |
|---|---|
| Molecular Weight | 234.29100 |
| Exact Mass | 234.12600 |
| PSA | 46.53000 |
| LogP | 2.28090 |
| InChIKey | NEAMXHCILVUVBV-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)C1CCCC(O)C1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Hydroxy-cyclohexanecarboxylic acid benzyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of benzyl 3-hydroxycyclohexanecarboxylate? |
| A: SMILES notation of benzyl 3-hydroxycyclohexanecarboxylate is O=C(OCc1ccccc1)C1CCCC(O)C1. |
| Q: What is the LogP of benzyl 3-hydroxycyclohexanecarboxylate? |
| A: LogP of benzyl 3-hydroxycyclohexanecarboxylate is 2.28090. |
| Q: What is the Chinese name of 123762-07-2? |
| A: Chinese name of 123762-07-2 is 123762-07-2. |
| Q: What is the CAS number of benzyl 3-hydroxycyclohexanecarboxylate? |
| A: CAS number of benzyl 3-hydroxycyclohexanecarboxylate is 123762-07-2. |
| Q: What is the molecular weight of benzyl 3-hydroxycyclohexanecarboxylate? |
| A: Molecular weight of benzyl 3-hydroxycyclohexanecarboxylate is 234.29100. |
| Q: What is the InChIKey of benzyl 3-hydroxycyclohexanecarboxylate? |
| A: InChIKey of benzyl 3-hydroxycyclohexanecarboxylate is NEAMXHCILVUVBV-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of benzyl 3-hydroxycyclohexanecarboxylate? |
| A: Polar surface area (PSA) of benzyl 3-hydroxycyclohexanecarboxylate is 46.53000. |
| Q: What is the molecular formula of benzyl 3-hydroxycyclohexanecarboxylate? |
| A: Molecular formula of benzyl 3-hydroxycyclohexanecarboxylate is C14H18O3. |
| Q: What is the English name of benzyl 3-hydroxycyclohexanecarboxylate? |
| A: The English name of benzyl 3-hydroxycyclohexanecarboxylate is benzyl 3-hydroxycyclohexanecarboxylate. |
| Q: What English synonyms does benzyl 3-hydroxycyclohexanecarboxylate have? |
| A: English synonyms of benzyl 3-hydroxycyclohexanecarboxylate: 3-Hydroxy-cyclohexanecarboxylic acid benzyl ester. |