(S)-benzyl 3-oxocyclohexanecarboxylate
Modify Date: 2026-07-01 19:47:28
(S)-benzyl 3-oxocyclohexanecarboxylate structure
|
Common Name | (S)-benzyl 3-oxocyclohexanecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 123762-08-3 | Molecular Weight | 232.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-benzyl 3-oxocyclohexanecarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16O3 |
|---|---|
| Molecular Weight | 232.27500 |
| Exact Mass | 232.11000 |
| PSA | 43.37000 |
| LogP | 2.48910 |
| InChIKey | CHIOEOLAODNQQH-UHFFFAOYSA-N |
| SMILES | O=C1CCCC(C(=O)OCc2ccccc2)C1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| benzyl 3-oxocyclohexanecarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (S)-benzyl 3-oxocyclohexanecarboxylate? |
| A: Molecular formula of (S)-benzyl 3-oxocyclohexanecarboxylate is C14H16O3. |
| Q: What is the English name of (S)-benzyl 3-oxocyclohexanecarboxylate? |
| A: The English name of (S)-benzyl 3-oxocyclohexanecarboxylate is (S)-benzyl 3-oxocyclohexanecarboxylate. |
| Q: What is the Chinese name of 123762-08-3? |
| A: Chinese name of 123762-08-3 is 123762-08-3. |
| Q: What English synonyms does (S)-benzyl 3-oxocyclohexanecarboxylate have? |
| A: English synonyms of (S)-benzyl 3-oxocyclohexanecarboxylate: benzyl 3-oxocyclohexanecarboxylate. |
| Q: What is the SMILES notation of (S)-benzyl 3-oxocyclohexanecarboxylate? |
| A: SMILES notation of (S)-benzyl 3-oxocyclohexanecarboxylate is O=C1CCCC(C(=O)OCc2ccccc2)C1. |
| Q: What is the LogP of (S)-benzyl 3-oxocyclohexanecarboxylate? |
| A: LogP of (S)-benzyl 3-oxocyclohexanecarboxylate is 2.48910. |
| Q: What is the CAS number of (S)-benzyl 3-oxocyclohexanecarboxylate? |
| A: CAS number of (S)-benzyl 3-oxocyclohexanecarboxylate is 123762-08-3. |
| Q: What is the polar surface area (PSA) of (S)-benzyl 3-oxocyclohexanecarboxylate? |
| A: Polar surface area (PSA) of (S)-benzyl 3-oxocyclohexanecarboxylate is 43.37000. |
| Q: What is the InChIKey of (S)-benzyl 3-oxocyclohexanecarboxylate? |
| A: InChIKey of (S)-benzyl 3-oxocyclohexanecarboxylate is CHIOEOLAODNQQH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (S)-benzyl 3-oxocyclohexanecarboxylate? |
| A: Molecular weight of (S)-benzyl 3-oxocyclohexanecarboxylate is 232.27500. |