4-Cyclohexyl-2,6-bis(hydroxymethyl)phenol structure
|
Common Name | 4-Cyclohexyl-2,6-bis(hydroxymethyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 123766-40-5 | Molecular Weight | 236.307 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 413.1±14.0 °C at 760 mmHg | |
| Molecular Formula | C14H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.2±14.7 °C | |
| Name | 4-cyclohexyl-2,6-bis(hydroxymethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 413.1±14.0 °C at 760 mmHg |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.307 |
| Flash Point | 198.2±14.7 °C |
| Exact Mass | 236.141251 |
| PSA | 60.69000 |
| LogP | 1.63 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | OWTGALWHQDVEKQ-UHFFFAOYSA-N |
| SMILES | OCc1cc(C2CCCCC2)cc(CO)c1O |
|
~79%
4-Cyclohexyl-2,... CAS#:123766-40-5 |
| Literature: Sone, Tyo; Ohba, Yoshihiro; Yamazaki, Hajime Bulletin of the Chemical Society of Japan, 1989 , vol. 62, # 4 p. 1111 - 1116 |
|
~%
4-Cyclohexyl-2,... CAS#:123766-40-5 |
| Literature: Zinke; Hanus; Ziegler Journal fuer Praktische Chemie (Leipzig), 1939 , vol. <2> 152, p. 126,135 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Cyclohexyl-2,6-bis-hydroxymethyl-phenol |
| 1,3-Benzenedimethanol,5-cyclohexyl-2-hydroxy |
| 2-Hydroxy-1,3-bis-hydroxymethyl-5-cyclohexyl-benzol |
| 2,6-di(hydroxymethyl)-4-cyclohexylphenol |
| 4-Cyclohexyl-2,6-bis(hydroxymethyl)phenol |