(4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone
(4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone structure
|
Common Name | (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 123769-34-6 | Molecular Weight | 333.17700 | |
| Density | 1.446g/cm3 | Boiling Point | 453.1ºC at 760 mmHg | |
| Molecular Formula | C16H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.446g/cm3 |
|---|---|
| Boiling Point | 453.1ºC at 760 mmHg |
| Molecular Formula | C16H13BrO3 |
| Molecular Weight | 333.17700 |
| Flash Point | 227.8ºC |
| Exact Mass | 332.00500 |
| PSA | 35.53000 |
| LogP | 3.84140 |
| Vapour Pressure | 2.12E-08mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | KPYCKTBRONJFRV-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Br)cc1)c1ccc2c(c1)OCCCO2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![3,4-DIHYDRO-2H-BENZO[B][1,4]DIOXEPINE structure](https://image.chemsrc.com/caspic/407/7216-18-4.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (4-Bromo-phenyl)-(3,4-dihydro-2H-benzo[b][1,4]dioxepin-7-yl)-methanone |
| 2H-1,5-Benzodioxepine,3,4-dihydro-7-(p-bromobenzoyl) |
| (4-Bromophenyl)(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone |
| Methanone,(4-bromophenyl)(3,4-dihydro-2H-1,5-benzodioxepin-7-yl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone? |
| A: SMILES notation of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone is O=C(c1ccc(Br)cc1)c1ccc2c(c1)OCCCO2. |
| Q: What is the CAS number of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone? |
| A: CAS number of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone is 123769-34-6. |
| Q: What English synonyms does (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone have? |
| A: English synonyms of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone: (4-Bromo-phenyl)-(3,4-dihydro-2H-benzo[b][1,4]dioxepin-7-yl)-methanone, 2H-1,5-Benzodioxepine,3,4-dihydro-7-(p-bromobenzoyl), (4-Bromophenyl)(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone, Methanone,(4-bromophenyl)(3,4-dihydro-2H-1,5-benzodioxepin-7-yl). |
| Q: What is the InChIKey of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone? |
| A: InChIKey of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone is KPYCKTBRONJFRV-UHFFFAOYSA-N. |
| Q: What is the LogP of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone? |
| A: LogP of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone is 3.84140. |
| Q: What is the Chinese name of 123769-34-6? |
| A: Chinese name of 123769-34-6 is 123769-34-6. |
| Q: What is the polar surface area (PSA) of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone? |
| A: Polar surface area (PSA) of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone is 35.53000. |
| Q: What is the molecular weight of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone? |
| A: Molecular weight of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone is 333.17700. |
| Q: What is the molecular formula of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone? |
| A: Molecular formula of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone is C16H13BrO3. |
| Q: What is the boiling point of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone? |
| A: Boiling point of (4-bromophenyl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanone is 453.1ºC at 760 mmHg. |