(3,4-dipropoxyphenyl)-phenylmethanone
(3,4-dipropoxyphenyl)-phenylmethanone structure
|
Common Name | (3,4-dipropoxyphenyl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 123769-53-9 | Molecular Weight | 298.37600 | |
| Density | 1.059g/cm3 | Boiling Point | 431.5ºC at 760 mmHg | |
| Molecular Formula | C19H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3,4-dipropoxyphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.059g/cm3 |
|---|---|
| Boiling Point | 431.5ºC at 760 mmHg |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.37600 |
| Flash Point | 206.6ºC |
| Exact Mass | 298.15700 |
| PSA | 35.53000 |
| LogP | 4.49520 |
| Vapour Pressure | 1.2E-07mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | DSLQERVRCPYMRC-UHFFFAOYSA-N |
| SMILES | CCCOc1ccc(C(=O)c2ccccc2)cc1OCCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (3,4-Dipropoxyphenyl)phenylmethanone |
| Methanone,(3,4-dipropoxyphenyl)phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (3,4-dipropoxyphenyl)-phenylmethanone? |
| A: Molecular formula of (3,4-dipropoxyphenyl)-phenylmethanone is C19H22O3. |
| Q: What is the molecular weight of (3,4-dipropoxyphenyl)-phenylmethanone? |
| A: Molecular weight of (3,4-dipropoxyphenyl)-phenylmethanone is 298.37600. |
| Q: What English synonyms does (3,4-dipropoxyphenyl)-phenylmethanone have? |
| A: English synonyms of (3,4-dipropoxyphenyl)-phenylmethanone: (3,4-Dipropoxyphenyl)phenylmethanone, Methanone,(3,4-dipropoxyphenyl)phenyl. |
| Q: What is the CAS number of (3,4-dipropoxyphenyl)-phenylmethanone? |
| A: CAS number of (3,4-dipropoxyphenyl)-phenylmethanone is 123769-53-9. |
| Q: What is the boiling point of (3,4-dipropoxyphenyl)-phenylmethanone? |
| A: Boiling point of (3,4-dipropoxyphenyl)-phenylmethanone is 431.5ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of (3,4-dipropoxyphenyl)-phenylmethanone? |
| A: Polar surface area (PSA) of (3,4-dipropoxyphenyl)-phenylmethanone is 35.53000. |
| Q: What is the English name of (3,4-dipropoxyphenyl)-phenylmethanone? |
| A: The English name of (3,4-dipropoxyphenyl)-phenylmethanone is (3,4-dipropoxyphenyl)-phenylmethanone. |
| Q: What are the upstream materials of (3,4-dipropoxyphenyl)-phenylmethanone? |
| A: Related upstream materials(CAS) of (3,4-dipropoxyphenyl)-phenylmethanone: 6280-98-4;98-88-4. |
| Q: What is the InChIKey of (3,4-dipropoxyphenyl)-phenylmethanone? |
| A: InChIKey of (3,4-dipropoxyphenyl)-phenylmethanone is DSLQERVRCPYMRC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (3,4-dipropoxyphenyl)-phenylmethanone? |
| A: SMILES notation of (3,4-dipropoxyphenyl)-phenylmethanone is CCCOc1ccc(C(=O)c2ccccc2)cc1OCCC. |