1-[4-[2-(4-aminophenyl)ethynyl]phenyl]ethanone structure
|
Common Name | 1-[4-[2-(4-aminophenyl)ethynyl]phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 123770-68-3 | Molecular Weight | 235.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-[2-(4-aminophenyl)ethynyl]phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13NO |
|---|---|
| Molecular Weight | 235.28100 |
| Exact Mass | 235.10000 |
| PSA | 43.09000 |
| LogP | 3.45240 |
| InChIKey | HFMSZLCLBXYFOM-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(C#Cc2ccc(N)cc2)cc1 |
|
~93%
1-[4-[2-(4-amin... CAS#:123770-68-3 |
| Literature: Lohmann, Sophie; Andrews, Stephen P.; Burke, Brenda J.; Smith, Martin D.; Attfield, J. Paul; Tanaka, Hirohisa; Kaneko, Kimiyoshi; Ley, Steven V. Synlett, 2005 , # 8 art. no. D03505ST, p. 1291 - 1295 |
|
~41%
1-[4-[2-(4-amin... CAS#:123770-68-3 |
| Literature: Stiegman; Graham, Eva; Perry, Kelly J.; Khundkar, Lutfur R.; Cheng; Perry, Joseph W. Journal of the American Chemical Society, 1991 , vol. 113, # 20 p. 7658 - 7666 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Ethanone,1-[4-[(4-aminophenyl)ethynyl]phenyl] |