ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate
ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate structure
|
Common Name | ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 123771-00-6 | Molecular Weight | 290.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14O6 |
|---|---|
| Molecular Weight | 290.26800 |
| Exact Mass | 290.07900 |
| PSA | 74.97000 |
| LogP | 3.03520 |
| InChIKey | YKKQGIQOIAHRAL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(Oc2ccccc2C(=O)OC)o1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~24%
ethyl 5-(2-meth... CAS#:123771-00-6 |
| Literature: Kuo; Wu; Huang; Chou Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 3 p. 605 - 608 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Furancarboxylic acid,5-[2-(methoxycarbonyl)phenoxy]-,ethyl ester |
| Ethyl 5-(2'-methoxycarbonylphenoxy)furan-2-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate? |
| A: Related upstream materials(CAS) of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate: 943-37-3;119-36-8. |
| Q: What is the molecular formula of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate? |
| A: Molecular formula of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate is C15H14O6. |
| Q: What is the CAS number of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate? |
| A: CAS number of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate is 123771-00-6. |
| Q: What is the LogP of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate? |
| A: LogP of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate is 3.03520. |
| Q: What is the SMILES notation of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate? |
| A: SMILES notation of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate is CCOC(=O)c1ccc(Oc2ccccc2C(=O)OC)o1. |
| Q: What is the InChIKey of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate? |
| A: InChIKey of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate is YKKQGIQOIAHRAL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate? |
| A: Molecular weight of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate is 290.26800. |
| Q: What is the English name of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate? |
| A: The English name of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate is ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate. |
| Q: What is the Chinese name of 123771-00-6? |
| A: Chinese name of 123771-00-6 is 123771-00-6. |
| Q: What English synonyms does ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate have? |
| A: English synonyms of ethyl 5-(2-methoxycarbonylphenoxy)furan-2-carboxylate: 2-Furancarboxylic acid,5-[2-(methoxycarbonyl)phenoxy]-,ethyl ester, Ethyl 5-(2'-methoxycarbonylphenoxy)furan-2-carboxylate. |