Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester
Modify Date: 2026-08-03 12:18:48
![Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester Structure](https://www.chemsrc.com/extcaspic/053/123772-41-8.png)
Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester structure
|
Common Name | Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester | ||
|---|---|---|---|---|
| CAS Number | 123772-41-8 | Molecular Weight | 342.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9Cl2N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9Cl2N3O2S |
|---|---|
| Molecular Weight | 342.2 |
| InChIKey | GHTVUEWSENRNNB-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)OCc1c(Cl)nc2sccn12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester? |
| A: SMILES notation of Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester is O=C(Nc1ccc(Cl)cc1)OCc1c(Cl)nc2sccn12. |
| Q: What is the CAS number of Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester? |
| A: CAS number of Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester is 123772-41-8. |
| Q: What is the English name of Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester? |
| A: The English name of Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester is Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester. |
| Q: What is the molecular formula of Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester? |
| A: Molecular formula of Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester is C13H9Cl2N3O2S. |
| Q: What is the InChIKey of Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester? |
| A: InChIKey of Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester is GHTVUEWSENRNNB-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 123772-41-8? |
| A: Chinese name of 123772-41-8 is 123772-41-8. |
| Q: What is the molecular weight of Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester? |
| A: Molecular weight of Carbamic acid, (4-chlorophenyl)-, (6-chloroimidazo[2,1-b]thiazol-5-yl)methyl ester is 342.2. |