eta-Tocopherol 4-phenylazobenzoate
Modify Date: 2025-10-05 18:10:29
eta-Tocopherol 4-phenylazobenzoate structure
|
Common Name | eta-Tocopherol 4-phenylazobenzoate | ||
|---|---|---|---|---|
| CAS Number | 123777-40-2 | Molecular Weight | 610.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H54N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | eta-Tocopherol 4-phenylazobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C40H54N2O3 |
|---|---|
| Molecular Weight | 610.9 |
| InChIKey | UNOYNWSDGSKIKP-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(cc1OC(=O)c1ccc(N=Nc3ccccc3)cc1)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of eta-Tocopherol 4-phenylazobenzoate? |
| A: InChIKey of eta-Tocopherol 4-phenylazobenzoate is UNOYNWSDGSKIKP-UHFFFAOYSA-N. |
| Q: What is the molecular formula of eta-Tocopherol 4-phenylazobenzoate? |
| A: Molecular formula of eta-Tocopherol 4-phenylazobenzoate is C40H54N2O3. |
| Q: What is the molecular weight of eta-Tocopherol 4-phenylazobenzoate? |
| A: Molecular weight of eta-Tocopherol 4-phenylazobenzoate is 610.9. |
| Q: What is the English name of eta-Tocopherol 4-phenylazobenzoate? |
| A: The English name of eta-Tocopherol 4-phenylazobenzoate is eta-Tocopherol 4-phenylazobenzoate. |
| Q: What is the SMILES notation of eta-Tocopherol 4-phenylazobenzoate? |
| A: SMILES notation of eta-Tocopherol 4-phenylazobenzoate is Cc1cc2c(cc1OC(=O)c1ccc(N=Nc3ccccc3)cc1)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2. |
| Q: What is the CAS number of eta-Tocopherol 4-phenylazobenzoate? |
| A: CAS number of eta-Tocopherol 4-phenylazobenzoate is 123777-40-2. |
| Q: What is the Chinese name of 123777-40-2? |
| A: Chinese name of 123777-40-2 is 123777-40-2. |