4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester
Modify Date: 2025-11-03 18:49:52
![4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester Structure](https://www.chemsrc.com/extcaspic/291/123790-27-2.png)
4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester structure
|
Common Name | 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester | ||
|---|---|---|---|---|
| CAS Number | 123790-27-2 | Molecular Weight | 286.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H22O3 |
|---|---|
| Molecular Weight | 286.4 |
| InChIKey | BKMRIFJTSRKVRD-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)C1(O)C=CC(c2ccccc2)=CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester? |
| A: InChIKey of 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester is BKMRIFJTSRKVRD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 123790-27-2? |
| A: Chinese name of 123790-27-2 is 123790-27-2. |
| Q: What is the CAS number of 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester? |
| A: CAS number of 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester is 123790-27-2. |
| Q: What is the molecular formula of 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester? |
| A: Molecular formula of 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester is C18H22O3. |
| Q: What is the SMILES notation of 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester? |
| A: SMILES notation of 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester is CCCCCOC(=O)C1(O)C=CC(c2ccccc2)=CC1. |
| Q: What is the molecular weight of 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester? |
| A: Molecular weight of 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester is 286.4. |
| Q: What is the English name of 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester? |
| A: The English name of 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester is 4-Hydroxy-[1,1-biphenyl]-4-carboxylic acid pentyl ester. |