3-Nitro-5-phenylpyridine
3-Nitro-5-phenylpyridine structure
|
Common Name | 3-Nitro-5-phenylpyridine | ||
|---|---|---|---|---|
| CAS Number | 123792-62-1 | Molecular Weight | 200.19300 | |
| Density | 1.252g/cm3 | Boiling Point | 353.1ºC at 760mmHg | |
| Molecular Formula | C11H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Nitro-5-phenylpyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 353.1ºC at 760mmHg |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.19300 |
| Flash Point | 167.3ºC |
| Exact Mass | 200.05900 |
| PSA | 58.71000 |
| LogP | 3.18000 |
| Vapour Pressure | 7.49E-05mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | LXBLPKWPBMJMOW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cncc(-c2ccccc2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~6%
3-Nitro-5-pheny... CAS#:123792-62-1
Learn More
|
| Literature: Journal of the American Chemical Society, , vol. 133, # 41 p. 16338 - 16341 |
|
~27%
3-Nitro-5-pheny... CAS#:123792-62-1 |
| Literature: Tetrahedron, , vol. 45, # 9 p. 2693 - 2702 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Pyridine,3-nitro-5-phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 3-Nitro-5-phenylpyridine? |
| A: Boiling point of 3-Nitro-5-phenylpyridine is 353.1ºC at 760mmHg. |
| Q: What is the LogP of 3-Nitro-5-phenylpyridine? |
| A: LogP of 3-Nitro-5-phenylpyridine is 3.18000. |
| Q: What is the SMILES notation of 3-Nitro-5-phenylpyridine? |
| A: SMILES notation of 3-Nitro-5-phenylpyridine is O=[N+]([O-])c1cncc(-c2ccccc2)c1. |
| Q: What English synonyms does 3-Nitro-5-phenylpyridine have? |
| A: English synonyms of 3-Nitro-5-phenylpyridine: Pyridine,3-nitro-5-phenyl. |
| Q: What is the CAS number of 3-Nitro-5-phenylpyridine? |
| A: CAS number of 3-Nitro-5-phenylpyridine is 123792-62-1. |
| Q: What are the upstream materials of 3-Nitro-5-phenylpyridine? |
| A: Related upstream materials(CAS) of 3-Nitro-5-phenylpyridine: 2530-26-9;108-86-1;39166-25-1;14080-32-1. |
| Q: What is the English name of 3-Nitro-5-phenylpyridine? |
| A: The English name of 3-Nitro-5-phenylpyridine is 3-Nitro-5-phenylpyridine. |
| Q: What is the InChIKey of 3-Nitro-5-phenylpyridine? |
| A: InChIKey of 3-Nitro-5-phenylpyridine is LXBLPKWPBMJMOW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-Nitro-5-phenylpyridine? |
| A: Molecular weight of 3-Nitro-5-phenylpyridine is 200.19300. |
| Q: What is the molecular formula of 3-Nitro-5-phenylpyridine? |
| A: Molecular formula of 3-Nitro-5-phenylpyridine is C11H8N2O2. |