6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine structure
|
Common Name | 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine | ||
|---|---|---|---|---|
| CAS Number | 123792-65-4 | Molecular Weight | 221.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11N3O3 |
|---|---|
| Molecular Weight | 221.21 |
| InChIKey | ABCZDDMKAZDLSK-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCc2ncc([N+](=O)[O-])cc2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine? |
| A: SMILES notation of 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine is CC(=O)N1CCc2ncc([N+](=O)[O-])cc2C1. |
| Q: What is the molecular weight of 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine? |
| A: Molecular weight of 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine is 221.21. |
| Q: What is the English name of 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine? |
| A: The English name of 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine is 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine. |
| Q: What is the Chinese name of 123792-65-4? |
| A: Chinese name of 123792-65-4 is 123792-65-4. |
| Q: What is the InChIKey of 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine? |
| A: InChIKey of 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine is ABCZDDMKAZDLSK-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine? |
| A: Molecular formula of 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine is C10H11N3O3. |
| Q: What is the CAS number of 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine? |
| A: CAS number of 6-Acetyl-3-nitro-5,6,7,8-tetrahydro[1,6]naphthyridine is 123792-65-4. |