(R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate
Modify Date: 2026-07-02 15:35:17
(R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate structure
|
Common Name | (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 123795-41-5 | Molecular Weight | 329.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H23NO4 |
|---|---|
| Molecular Weight | 329.4 |
| InChIKey | GUZJZIQXCBCAGJ-MRXNPFEDSA-N |
| SMILES | COC(=O)C(Cc1ccc2ccccc2c1)NC(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 123795-41-5? |
| A: Chinese name of 123795-41-5 is 123795-41-5. |
| Q: What is the InChIKey of (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate? |
| A: InChIKey of (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate is GUZJZIQXCBCAGJ-MRXNPFEDSA-N. |
| Q: What is the English name of (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate? |
| A: The English name of (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate is (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate. |
| Q: What is the molecular formula of (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate? |
| A: Molecular formula of (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate is C19H23NO4. |
| Q: What is the CAS number of (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate? |
| A: CAS number of (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate is 123795-41-5. |
| Q: What is the molecular weight of (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate? |
| A: Molecular weight of (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate is 329.4. |
| Q: What is the SMILES notation of (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate? |
| A: SMILES notation of (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoate is COC(=O)C(Cc1ccc2ccccc2c1)NC(=O)OC(C)(C)C. |