2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane
Modify Date: 2025-11-11 17:37:26
2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane structure
|
Common Name | 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 123796-61-2 | Molecular Weight | 289.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13BrO4 |
|---|---|
| Molecular Weight | 289.12 |
| InChIKey | IFHSHLZKBBYEOV-UHFFFAOYSA-N |
| SMILES | COc1cc(C2OCCO2)cc(OC)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane? |
| A: Molecular weight of 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane is 289.12. |
| Q: What is the Chinese name of 123796-61-2? |
| A: Chinese name of 123796-61-2 is 123796-61-2. |
| Q: What is the English name of 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane? |
| A: The English name of 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane is 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane. |
| Q: What is the molecular formula of 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane? |
| A: Molecular formula of 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane is C11H13BrO4. |
| Q: What is the CAS number of 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane? |
| A: CAS number of 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane is 123796-61-2. |
| Q: What is the SMILES notation of 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane? |
| A: SMILES notation of 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane is COc1cc(C2OCCO2)cc(OC)c1Br. |
| Q: What is the InChIKey of 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane? |
| A: InChIKey of 2-(4-Bromo-3,5-dimethoxyphenyl)-1,3-dioxolane is IFHSHLZKBBYEOV-UHFFFAOYSA-N. |