3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl structure
|
Common Name | 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl | ||
|---|---|---|---|---|
| CAS Number | 1237986-68-3 | Molecular Weight | 262.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8BrNO |
|---|---|
| Molecular Weight | 262.10 |
| InChIKey | FANOOJVAEMZNQB-UHFFFAOYSA-N |
| SMILES | O=Cc1c(-c2ccccc2)ccnc1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl? |
| A: CAS number of 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl is 1237986-68-3. |
| Q: What is the Chinese name of 1237986-68-3? |
| A: Chinese name of 1237986-68-3 is 1237986-68-3. |
| Q: What is the InChIKey of 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl? |
| A: InChIKey of 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl is FANOOJVAEMZNQB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl? |
| A: SMILES notation of 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl is O=Cc1c(-c2ccccc2)ccnc1Br. |
| Q: What is the molecular weight of 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl? |
| A: Molecular weight of 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl is 262.10. |
| Q: What is the molecular formula of 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl? |
| A: Molecular formula of 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl is C12H8BrNO. |
| Q: What is the English name of 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl? |
| A: The English name of 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl is 3-Pyridinecarboxaldehyde, 2-bromo-4-phenyl. |