α-Isopropyl-α-(2-morpholinoethyl)-1-naphthaleneacetonitrile structure
|
Common Name | α-Isopropyl-α-(2-morpholinoethyl)-1-naphthaleneacetonitrile | ||
|---|---|---|---|---|
| CAS Number | 1238-65-9 | Molecular Weight | 322.44400 | |
| Density | 1.081g/cm3 | Boiling Point | 499.6ºC at 760mmHg | |
| Molecular Formula | C21H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256ºC | |
| Name | 3-methyl-2-(2-morpholin-4-ylethyl)-2-naphthalen-1-ylbutanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 499.6ºC at 760mmHg |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.44400 |
| Flash Point | 256ºC |
| Exact Mass | 322.20500 |
| PSA | 36.26000 |
| LogP | 3.91738 |
| Vapour Pressure | 4.08E-10mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | OGRZCCCGYFWIDL-UHFFFAOYSA-N |
| SMILES | CC(C)C(C#N)(CCN1CCOCC1)c1cccc2ccccc12 |
| HS Code | 2934999090 |
|---|
|
~%
α-Isopropyl-α-(... CAS#:1238-65-9 |
| Literature: Casadio,S. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 589 - 593 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-methyl-2-[2-(morpholin-4-yl)ethyl]-2-(naphthalen-1-yl)butanenitrile |
| 3-methyl-2-(2-morpholin-4-yl-ethyl)-2-naphthalen-1-yl-butyronitrile |