3-[2-(4-oxo-2-phenylquinazolin-3-yl)ethyl]benzoic acid structure
|
Common Name | 3-[2-(4-oxo-2-phenylquinazolin-3-yl)ethyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 123845-83-0 | Molecular Weight | 370.40100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[2-(4-oxo-2-phenylquinazolin-3-yl)ethyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H18N2O3 |
|---|---|
| Molecular Weight | 370.40100 |
| Exact Mass | 370.13200 |
| PSA | 72.19000 |
| LogP | 4.00440 |
| InChIKey | PHOGTKZJNJOIEV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(CCn2c(-c3ccccc3)nc3ccccc3c2=O)c1 |
|
~%
3-[2-(4-oxo-2-p... CAS#:123845-83-0 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 44, # 1 p. 158 - 162 |
|
~%
3-[2-(4-oxo-2-p... CAS#:123845-83-0 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 44, # 1 p. 158 - 162 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzoic acid,3-[2-(4-oxo-2-phenyl-3(4H)-quinazolinyl)ethyl] |