1-methyl-4-[(4-methylphenoxy)-propan-2-ylphosphoryl]oxybenzene structure
|
Common Name | 1-methyl-4-[(4-methylphenoxy)-propan-2-ylphosphoryl]oxybenzene | ||
|---|---|---|---|---|
| CAS Number | 123872-74-2 | Molecular Weight | 304.32100 | |
| Density | 1.119g/cm3 | Boiling Point | 403.7ºC at 760 mmHg | |
| Molecular Formula | C17H21O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.4ºC | |
| Name | 1-methyl-4-[(4-methylphenoxy)-propan-2-ylphosphoryl]oxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 403.7ºC at 760 mmHg |
| Molecular Formula | C17H21O3P |
| Molecular Weight | 304.32100 |
| Flash Point | 211.4ºC |
| Exact Mass | 304.12300 |
| PSA | 45.34000 |
| LogP | 5.36270 |
| Vapour Pressure | 2.33E-06mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | IKZMRVSMVYRWBV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OP(=O)(Oc2ccc(C)cc2)C(C)C)cc1 |
|
~%
1-methyl-4-[(4-... CAS#:123872-74-2 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 27, # 1-12 p. 1024 - 1028 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonic acid,(1-methylethyl)-,bis(4-methylphenyl) ester |
| 1-methyl-4-[(4-methylphenoxy)-propan-2-yl-phosphoryl]oxy-benzene |