1-tert-butyl-4-[(4-tert-butylphenoxy)-propan-2-ylphosphoryl]oxybenzene structure
|
Common Name | 1-tert-butyl-4-[(4-tert-butylphenoxy)-propan-2-ylphosphoryl]oxybenzene | ||
|---|---|---|---|---|
| CAS Number | 123872-76-4 | Molecular Weight | 388.48000 | |
| Density | 1.042g/cm3 | Boiling Point | 459.2ºC at 760mmHg | |
| Molecular Formula | C23H33O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.8ºC | |
| Name | 1-tert-butyl-4-[(4-tert-butylphenoxy)-propan-2-ylphosphoryl]oxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 459.2ºC at 760mmHg |
| Molecular Formula | C23H33O3P |
| Molecular Weight | 388.48000 |
| Flash Point | 244.8ºC |
| Exact Mass | 388.21700 |
| PSA | 45.34000 |
| LogP | 7.34090 |
| Vapour Pressure | 3.53E-08mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | DTTYLOMLSWKOPW-UHFFFAOYSA-N |
| SMILES | CC(C)P(=O)(Oc1ccc(C(C)(C)C)cc1)Oc1ccc(C(C)(C)C)cc1 |
|
~%
1-tert-butyl-4-... CAS#:123872-76-4 |
| Literature: Nidiry, Eugene Sebastian J.; Roy, N. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 1024 - 1028 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonic acid,(1-methylethyl)-,bis(2-t-butylphenyl) ester |
| O,O-bis(4-t-butylphenyl) isopropyl phosphonate |