1-methylsulfanyl-4-[(4-methylsulfanylphenoxy)-propan-2-ylphosphoryl]oxybenzene structure
|
Common Name | 1-methylsulfanyl-4-[(4-methylsulfanylphenoxy)-propan-2-ylphosphoryl]oxybenzene | ||
|---|---|---|---|---|
| CAS Number | 123872-77-5 | Molecular Weight | 368.45100 | |
| Density | 1.23g/cm3 | Boiling Point | 483.5ºC at 760mmHg | |
| Molecular Formula | C17H21O3PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.2ºC | |
| Name | 1-methylsulfanyl-4-[(4-methylsulfanylphenoxy)-propan-2-ylphosphoryl]oxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 483.5ºC at 760mmHg |
| Molecular Formula | C17H21O3PS2 |
| Molecular Weight | 368.45100 |
| Flash Point | 246.2ºC |
| Exact Mass | 368.06700 |
| PSA | 95.94000 |
| LogP | 6.18970 |
| Vapour Pressure | 4.89E-09mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | SJYCEBKDEVWJOH-UHFFFAOYSA-N |
| SMILES | CSc1ccc(OP(=O)(Oc2ccc(SC)cc2)C(C)C)cc1 |
|
~%
1-methylsulfany... CAS#:123872-77-5 |
| Literature: Nidiry, Eugene Sebastian J.; Roy, N. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 1024 - 1028 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonic acid,(1-methylethyl)-,bis(4-methylthiophenyl) ester |
| Phosphonic acid,(1-methylethyl)-,bis[4-(methylthio)phenyl] ester (9CI) |
| bis[4-(methylsulfanyl)phenyl] propan-2-ylphosphonate |