1,2,5-trimethyl-3-[propan-2-yl-(2,3,5-trimethylphenoxy)phosphoryl]oxybenzene structure
|
Common Name | 1,2,5-trimethyl-3-[propan-2-yl-(2,3,5-trimethylphenoxy)phosphoryl]oxybenzene | ||
|---|---|---|---|---|
| CAS Number | 123872-82-2 | Molecular Weight | 360.42700 | |
| Density | 1.069g/cm3 | Boiling Point | 474.3ºC at 760 mmHg | |
| Molecular Formula | C21H29O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.9ºC | |
| Name | 1,2,5-trimethyl-3-[propan-2-yl-(2,3,5-trimethylphenoxy)phosphoryl]oxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.069g/cm3 |
|---|---|
| Boiling Point | 474.3ºC at 760 mmHg |
| Molecular Formula | C21H29O3P |
| Molecular Weight | 360.42700 |
| Flash Point | 253.9ºC |
| Exact Mass | 360.18500 |
| PSA | 45.34000 |
| LogP | 6.59630 |
| Vapour Pressure | 1.05E-08mmHg at 25°C |
| Index of Refraction | 1.53 |
| InChIKey | IKDZWXXQZQXJHB-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C)c(OP(=O)(Oc2cc(C)cc(C)c2C)C(C)C)c1 |
|
~%
1,2,5-trimethyl... CAS#:123872-82-2 |
| Literature: Nidiry, Eugene Sebastian J.; Roy, N. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 1024 - 1028 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonic acid,(1-methylethyl)-,bis(2,3,5-trimethylphenyl) ester |
| O,O-bis(2,3,5-trimethylphenyl) isopropyl phosphonate |
| 1,2,5-trimethyl-3-[propan-2-yl-(2,3,5-trimethylphenoxy)phosphoryl]oxy-benzene |