1,2,3,4,5-pentachloro-6-[(2,3,4,5,6-pentachlorophenoxy)-propan-2-ylphosphoryl]oxybenzene structure
|
Common Name | 1,2,3,4,5-pentachloro-6-[(2,3,4,5,6-pentachlorophenoxy)-propan-2-ylphosphoryl]oxybenzene | ||
|---|---|---|---|---|
| CAS Number | 123872-84-4 | Molecular Weight | 620.71800 | |
| Density | 1.729g/cm3 | Boiling Point | 613.2ºC at 760 mmHg | |
| Molecular Formula | C15H7Cl10O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 579.2ºC | |
| Name | 1,2,3,4,5-pentachloro-6-[(2,3,4,5,6-pentachlorophenoxy)-propan-2-ylphosphoryl]oxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.729g/cm3 |
|---|---|
| Boiling Point | 613.2ºC at 760 mmHg |
| Molecular Formula | C15H7Cl10O3P |
| Molecular Weight | 620.71800 |
| Flash Point | 579.2ºC |
| Exact Mass | 615.70200 |
| PSA | 45.34000 |
| LogP | 11.27990 |
| Vapour Pressure | 2.57E-14mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | JNRQMFAQFJMCRA-UHFFFAOYSA-N |
| SMILES | CC(C)P(=O)(Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
|
~%
1,2,3,4,5-penta... CAS#:123872-84-4 |
| Literature: Nidiry, Eugene Sebastian J.; Roy, N. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 1024 - 1028 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonic acid,(1-methylethyl)-,bis(pentachlorophenyl) ester |
| bis(pentachlorophenyl) propan-2-ylphosphonate |