methyl 4-(benzylamino)benzoate structure
|
Common Name | methyl 4-(benzylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 123876-56-2 | Molecular Weight | 241.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-(benzylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15NO2 |
|---|---|
| Molecular Weight | 241.28500 |
| Exact Mass | 241.11000 |
| PSA | 38.33000 |
| LogP | 3.15830 |
| InChIKey | LFUBRMQHWKUBDF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(NCc2ccccc2)cc1 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
|
Name: Inhibition of human carbonic anhydrase 1-catalyzed CO2 hydration preincubated for 10 ...
Source: ChEMBL
Target: Carbonic anhydrase 1
External Id: CHEMBL3269991
|
|
Name: Inhibition of human carbonic anhydrase 2-catalyzed CO2 hydration preincubated for 10 ...
Source: ChEMBL
Target: Carbonic anhydrase 2
External Id: CHEMBL3269990
|
|
Name: Selectivity ratio of Ki for human carbonic anhydrase 2 to Ki for human carbonic anhyd...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3269993
|
| Benzoic acid,4-[(phenylmethyl)amino]-,methyl ester |
| methyl 4-(benzylamino) benzoate |
| methyl 4-N-benzylaminobenzoate |