5-ethenyl-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione structure
|
Common Name | 5-ethenyl-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 123881-86-7 | Molecular Weight | 272.23000 | |
| Density | 1.52g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H13FN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-ethenyl-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Molecular Formula | C11H13FN2O5 |
| Molecular Weight | 272.23000 |
| Exact Mass | 272.08100 |
| PSA | 104.81000 |
| Index of Refraction | 1.598 |
| InChIKey | XPLOHHLOYRUBAI-FDDDBJFASA-N |
| SMILES | C=Cc1cn(C2OC(CO)C(O)C2F)c(=O)[nH]c1=O |
|
~18%
5-ethenyl-1-[(2... CAS#:123881-86-7 |
| Literature: Kumar, Rakesh; Xu, Lihua; Knaus, Edward E.; Wiebe, Leonard I.; Tovell, Dorothy R.; et al. Journal of Medicinal Chemistry, 1990 , vol. 33, # 2 p. 717 - 723 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-vinyl-2'-fluoro-2'-deoxyuridine |
| Uridine,2'-deoxy-5-ethenyl-2'-fluoro |
| 5-Vinyl-2'-fluoro-deoxyuridine |