1-[(3,5-dimethylphenoxy)-propan-2-ylphosphoryl]oxy-3,5-dimethylbenzene structure
|
Common Name | 1-[(3,5-dimethylphenoxy)-propan-2-ylphosphoryl]oxy-3,5-dimethylbenzene | ||
|---|---|---|---|---|
| CAS Number | 123901-50-8 | Molecular Weight | 332.37400 | |
| Density | 1.091g/cm3 | Boiling Point | 440.9ºC at 760 mmHg | |
| Molecular Formula | C19H25O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.8ºC | |
| Name | 1-[(3,5-dimethylphenoxy)-propan-2-ylphosphoryl]oxy-3,5-dimethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 440.9ºC at 760 mmHg |
| Molecular Formula | C19H25O3P |
| Molecular Weight | 332.37400 |
| Flash Point | 233.8ºC |
| Exact Mass | 332.15400 |
| PSA | 45.34000 |
| LogP | 5.97950 |
| Vapour Pressure | 1.47E-07mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | KKBADMMCPCACFB-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(OP(=O)(Oc2cc(C)cc(C)c2)C(C)C)c1 |
|
~%
1-[(3,5-dimethy... CAS#:123901-50-8 |
| Literature: Nidiry, Eugene Sebastian J.; Roy, N. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 1024 - 1028 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| bis(3,5-dimethylphenyl) propan-2-ylphosphonate |
| Phosphonic acid,(1-methylethyl)-,bis(3,5-dimethylphenyl) ester |