Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl)
Modify Date: 2025-09-10 09:09:43
Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl) structure
|
Common Name | Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 1239741-44-6 | Molecular Weight | 210.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H10N4O3 |
|---|---|
| Molecular Weight | 210.19 |
| InChIKey | RHMULGIPRNFXFE-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)NN |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl)? |
| A: The English name of Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl) is Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl). |
| Q: What is the InChIKey of Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl)? |
| A: InChIKey of Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl) is RHMULGIPRNFXFE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1239741-44-6? |
| A: Chinese name of 1239741-44-6 is 1239741-44-6. |
| Q: What is the molecular formula of Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl)? |
| A: Molecular formula of Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl) is C8H10N4O3. |
| Q: What is the molecular weight of Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl)? |
| A: Molecular weight of Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl) is 210.19. |
| Q: What is the CAS number of Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl)? |
| A: CAS number of Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl) is 1239741-44-6. |
| Q: What is the SMILES notation of Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl)? |
| A: SMILES notation of Hydrazinecarboxamide, N-(2-methyl-5-Nitrophenyl) is Cc1ccc([N+](=O)[O-])cc1NC(=O)NN. |