6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine
Modify Date: 2025-09-10 03:48:00
6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine structure
|
Common Name | 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine | ||
|---|---|---|---|---|
| CAS Number | 1239780-55-2 | Molecular Weight | 199.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H10ClN5 |
|---|---|
| Molecular Weight | 199.64 |
| InChIKey | ROYCHHSIZUWBOX-UHFFFAOYSA-N |
| SMILES | Nc1nc(Cl)c(N)c(NC2CC2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine? |
| A: The English name of 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine is 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine. |
| Q: What is the molecular formula of 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine? |
| A: Molecular formula of 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine is C7H10ClN5. |
| Q: What is the SMILES notation of 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine? |
| A: SMILES notation of 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine is Nc1nc(Cl)c(N)c(NC2CC2)n1. |
| Q: What is the InChIKey of 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine? |
| A: InChIKey of 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine is ROYCHHSIZUWBOX-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine? |
| A: Molecular weight of 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine is 199.64. |
| Q: What is the CAS number of 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine? |
| A: CAS number of 6-Chloro-N4-cyclopropylpyrimidine-2,4,5-triamine is 1239780-55-2. |
| Q: What is the Chinese name of 1239780-55-2? |
| A: Chinese name of 1239780-55-2 is 1239780-55-2. |