1-(4-Chlorophenyl)-2-cyclopropyl-1-propanone structure
|
Common Name | 1-(4-Chlorophenyl)-2-cyclopropyl-1-propanone | ||
|---|---|---|---|---|
| CAS Number | 123989-29-7 | Molecular Weight | 208.684 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 310.3±15.0 °C at 760 mmHg | |
| Molecular Formula | C12H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.7±11.5 °C | |
| Name | 1-(4-chlorophenyl)-2-cyclopropylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 310.3±15.0 °C at 760 mmHg |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.684 |
| Flash Point | 166.7±11.5 °C |
| Exact Mass | 208.065491 |
| PSA | 17.07000 |
| LogP | 3.60 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | LRWCURGZPQWMRG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)c1ccc(Cl)cc1)C1CC1 |
| HS Code | 2914700090 |
|---|
|
~%
1-(4-Chlorophen... CAS#:123989-29-7 |
| Literature: WO2010/142779 A1, ; Page/Page column 120 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-Propanone, 1-(4-chlorophenyl)-2-cyclopropyl- |
| 15729884 |
| 1-Propanone,1-(4-chlorophenyl)-2-cyclopropyl |
| 1-(4-chlorophenyl)-2-cyclopropylpropanone |
| L3TJ AY1&VR DG |
| 1-(4-Chlorophenyl)-2-cyclopropyl-1-propanone |