2-(3,4-dibromoanilino)-3,7-dihydropurin-6-one structure
|
Common Name | 2-(3,4-dibromoanilino)-3,7-dihydropurin-6-one | ||
|---|---|---|---|---|
| CAS Number | 123994-76-3 | Molecular Weight | 385.01400 | |
| Density | 2.26g/cm3 | Boiling Point | 605.2ºC at 760mmHg | |
| Molecular Formula | C11H7Br2N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.8ºC | |
| Name | 2-(3,4-dibromoanilino)-3,7-dihydropurin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.26g/cm3 |
|---|---|
| Boiling Point | 605.2ºC at 760mmHg |
| Molecular Formula | C11H7Br2N5O |
| Molecular Weight | 385.01400 |
| Flash Point | 319.8ºC |
| Exact Mass | 382.90200 |
| PSA | 89.95000 |
| LogP | 2.74900 |
| Vapour Pressure | 1.35E-14mmHg at 25°C |
| Index of Refraction | 1.862 |
| InChIKey | RXTCNVZMISLRJJ-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(Nc2ccc(Br)c(Br)c2)nc2nc[nH]c12 |
|
~35%
2-(3,4-dibromoa... CAS#:123994-76-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 1 p. 203 - 206 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6H-Purin-6-one,2-[(3,4-dibromophenyl)amino]-1,9-dihydro |