Hexachloromethyl-hexamethoxycalix-[6]arene structure
|
Common Name | Hexachloromethyl-hexamethoxycalix-[6]arene | ||
|---|---|---|---|---|
| CAS Number | 124006-38-8 | Molecular Weight | 1011.72000 | |
| Density | 1.251g/cm3 | Boiling Point | 1055ºC at 760mmHg | |
| Molecular Formula | C54H54Cl6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | Hexachloromethyl-hexamethoxycalix-[6]arene |
|---|
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 1055ºC at 760mmHg |
| Molecular Formula | C54H54Cl6O6 |
| Molecular Weight | 1011.72000 |
| Flash Point | 193.6ºC |
| Exact Mass | 1008.21000 |
| PSA | 55.38000 |
| LogP | 14.02920 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | CHHIYAIFEABSLY-UHFFFAOYSA-N |
| SMILES | COc1c2cc(CCl)cc1Cc1cc(CCl)cc(c1OC)Cc1cc(CCl)cc(c1OC)Cc1cc(CCl)cc(c1OC)Cc1cc(CCl)cc(c1OC)Cc1cc(CCl)cc(c1OC)C2 |
|
~%
Hexachloromethy... CAS#:124006-38-8 |
| Literature: Harrowfield, Jack M.; Mocerino, Mauro; Peachey, Brendan J.; Skelton, Brian W.; White, Allan H. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1996 , p. 1687 - 1700 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |