5-Bromopyrimidine-2,4-dicarboxylic acid
Modify Date: 2025-09-09 17:22:37
5-Bromopyrimidine-2,4-dicarboxylic acid structure
|
Common Name | 5-Bromopyrimidine-2,4-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1240598-34-8 | Molecular Weight | 247.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Bromopyrimidine-2,4-dicarboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H3BrN2O4 |
|---|---|
| Molecular Weight | 247.00 |
| InChIKey | JRMSTFBDURMUOX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ncc(Br)c(C(=O)O)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-Bromopyrimidine-2,4-dicarboxylic acid? |
| A: Molecular weight of 5-Bromopyrimidine-2,4-dicarboxylic acid is 247.00. |
| Q: What is the English name of 5-Bromopyrimidine-2,4-dicarboxylic acid? |
| A: The English name of 5-Bromopyrimidine-2,4-dicarboxylic acid is 5-Bromopyrimidine-2,4-dicarboxylic acid. |
| Q: What is the InChIKey of 5-Bromopyrimidine-2,4-dicarboxylic acid? |
| A: InChIKey of 5-Bromopyrimidine-2,4-dicarboxylic acid is JRMSTFBDURMUOX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1240598-34-8? |
| A: Chinese name of 1240598-34-8 is 1240598-34-8. |
| Q: What is the CAS number of 5-Bromopyrimidine-2,4-dicarboxylic acid? |
| A: CAS number of 5-Bromopyrimidine-2,4-dicarboxylic acid is 1240598-34-8. |
| Q: What is the molecular formula of 5-Bromopyrimidine-2,4-dicarboxylic acid? |
| A: Molecular formula of 5-Bromopyrimidine-2,4-dicarboxylic acid is C6H3BrN2O4. |
| Q: What is the SMILES notation of 5-Bromopyrimidine-2,4-dicarboxylic acid? |
| A: SMILES notation of 5-Bromopyrimidine-2,4-dicarboxylic acid is O=C(O)c1ncc(Br)c(C(=O)O)n1. |